On Target ACHA9_HUMAN 0.34710744/CHEMBL386114
For the given ligand WIN, we have found in our database that, being scored 0.34710744, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |