On Target DRD2_HUMAN 0.4712042/CHEMBL3409247
For the given ligand WIN, we have found in our database that, being scored 0.4712042, the most similar ligand is CHEMBL3409247. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3409247 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | NC(=O)c1ccccc1OCCCNCCc1cn(Cc2ccccc2)c2ccccc12 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04000002 00000a08 20100108 41010618 00045000 02020100 02002000 00001400 00500080 000908c0 08200004 40018020 10808822 00400000 01000041 000c200c 00200000 a2808000 00a00400 00020200 40000040 18228618 21800081 91500014 00042001 80000000 08000800 10000000 04000300 0006000a 80040200 00002660 |