On Target NEP_HUMAN 0.40528634/CHEMBL305388
For the given ligand WIN, we have found in our database that, being scored 0.40528634, the most similar ligand is CHEMBL305388. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL305388 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COc1ccc2c(c1)CC[C@H]2[C@@H](CS)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 00010002 43005e08 2010010a 41910610 00041080 40000002 03042000 20000005 00600880 000908c0 08300004 4003b000 1e00880a 20641800 81080041 020e000c 10000000 02000000 00682408 00420201 60000100 18208e18 23804340 91500018 00043801 80000001 08120000 10000000 04000202 0006003b 20044200 01012620 |