On Target OPRK_HUMAN 0.43661973/CHEMBL15498
For the given ligand WIN, we have found in our database that, being scored 0.43661973, the most similar ligand is CHEMBL15498. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL15498 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | O=c1c(-c2ccc(OC(F)(F)F)cc2)cccn1C(CN1CCC(O)C1)c1ccccc1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 00002002 00000608 20104108 40010610 20041092 04002158 02040000 20001000 06300081 400808e0 0c200004 40418000 00008832 00600000 011a0801 800c000c 10020000 82004004 04a00000 00020a03 40000000 38208010 33800089 83700010 0c040001 c0080000 08020200 d0040040 0e404200 0006005a 00240000 00002600 |