On Target AA1R_HUMAN 0.41312742/CHEMBL223002
For the given ligand WIN, we have found in our database that, being scored 0.41312742, the most similar ligand is CHEMBL223002. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL223002 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COc1ccc2[nH]c(C)c(CCOc3nc(N)c4ncn([C@@H]5O[C@H](CO)[C@@H](O)[C@H]5O)c4n3)c2c1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0000400a 03c01818 a0080108 d8090630 803c10e0 0000c100 060cac00 00008840 00410300 818838f0 0c04800c 40019004 02001906 03e88300 618e1ac1 121ec00c 18200020 02000004 1de00400 80221201 c00a0060 18008058 27804040 8c400014 10042400 c0000006 08160200 10000070 0200020c 00460802 c02c4200 0c0004e0 |