On Target TRPM4_HUMAN 0.27751195/CHEMBL1408302
For the given ligand WIN, we have found in our database that, being scored 0.27751195, the most similar ligand is CHEMBL1408302. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL1408302 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | O=C(COc1cccc2ccccc12)Nc1cc(Cl)ccc1C(=O)O |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 1401e002 00000808 20001108 01010602 00001080 00014040 0a000000 00080100 00800100 00080840 002c0084 4000d800 06808086 00100001 01021041 00080008 00040000 82000000 08000000 00024000 40100000 08060f28 32002000 00400004 00002000 80000000 08040018 00001080 00008200 00060001 c0000000 00020200 |