On Target AGTR2_HUMAN 0.3647541/CHEMBL2435821
For the given ligand WIN, we have found in our database that, being scored 0.3647541, the most similar ligand is CHEMBL2435821. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL2435821 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CCCc1nc2c(C)cc(C(=O)NCCCN3CCOCC3)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0800a00a 00809e01 00101500 90050610 000c00e1 0000c000 10000000 02001004 80500100 100019f0 0120800c 40818800 82009882 00608000 200b14c8 0a0c010c 10020008 06800004 04680008 50010201 c0000000 180e8e30 33800041 8150041c 00044400 c0000000 08000040 80000041 04404304 00c60819 e00c8004 200006a0 |