On Target P2Y12_HUMAN 0.3984064/CHEMBL3325895
For the given ligand WIN, we have found in our database that, being scored 0.3984064, the most similar ligand is CHEMBL3325895. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3325895 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CCCC(=O)c1cnn(-c2ccc(OC(=O)c3cn(CC(=O)N4CCN(C)CC4)c4ccc(Cl)cc34)cc2)c1C |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04008006 43803e08 2008018a 44810610 010c1100 4000c102 02042000 0000100c 10600900 000908c0 01200004 4001b800 0680888e 20612200 01010c61 0e0c200c 00020001 c2880000 00690100 00220801 c0000000 38078f78 30804822 83d0101e 08046000 c0002041 08060000 10000000 0c000684 10460019 c0040200 930206a0 |