On Target PRGR_HUMAN 0.46919432/CHEMBL1083359
For the given ligand WIN, we have found in our database that, being scored 0.46919432, the most similar ligand is CHEMBL1083359. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL1083359 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CCc1cn(CC(=O)NC)c(CC)c1Oc1ccc(C#N)cc1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0000000a 00004808 60100108 50058618 00005030 00004104 0e042000 00000208 00600004 108808d0 00208004 4085a000 00088086 0a000000 01020801 050c200c 00404000 c2800004 00a02500 00062000 04400020 38008610 20800400 0050a416 08042440 c0000000 08020000 10a00000 08041704 00060453 00020600 20240620 |