On Target DRD4_HUMAN 0.43096235/CHEMBL3577344
For the given ligand WIN, we have found in our database that, being scored 0.43096235, the most similar ligand is CHEMBL3577344. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3577344 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CCCCn1cc(CCCOc2ccc(C(=O)NCCCCN(CCC)CCc3ccc(O)c4[nH]c(=O)ccc34)cc2OC)nn1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04000002 56001818 60304109 40a10718 000c1000 42000064 06042000 22201200 06200880 500808e0 0c208004 40038840 9080ca86 00e02000 13114441 2a0ca00c 00000000 86000000 00680000 00260201 40020000 18268618 218010c0 8154901c 00202401 c2000000 00320040 90002010 04000304 0006000b b0040000 0400a660 |