On Target 5HT1B_HUMAN 0.4864865/CHEMBL357830
For the given ligand WIN, we have found in our database that, being scored 0.4864865, the most similar ligand is CHEMBL357830. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL357830 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | NCCc1c[nH]c2ccc(OCC(=O)N3CCC(C4CCN(C(=O)COc5ccc6[nH]cc(CCN)c6c5)CC4)CC3)cc12 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04002002 01001808 20100108 41010612 00041080 00000000 060c2000 20000000 00400000 000908c0 08240004 5001c000 10808806 00400000 01081041 000c000c 10000000 82000000 00202400 00020201 40000000 18048618 32800000 81500018 00042000 80000000 08120008 10000001 04000200 00060003 00040200 00000620 |