On Target NTRK1_HUMAN 0.49344978/CHEMBL3661539
For the given ligand WIN, we have found in our database that, being scored 0.49344978, the most similar ligand is CHEMBL3661539. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3661539 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COc1cc(F)cc2ccn(CC(=O)Nc3cncc(C(=O)c4cn(C(C)C)c5ncncc45)c3)c12 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 08004002 01805808 60184128 42040638 040c5010 0800c034 0e002000 01200004 00600100 40088ad0 2028000c 4005a000 00008806 08f01000 010008c1 140c000d 00070000 c280000c 08600400 40060004 e4100000 38048678 21802040 8050801e 08042442 a0100000 08000400 50000081 28401280 00478013 e0044210 000006a0 |