On Target MTOR_HUMAN 0.4857143/CHEMBL1089823
For the given ligand WIN, we have found in our database that, being scored 0.4857143, the most similar ligand is CHEMBL1089823. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL1089823 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COc1ccc2c(c1)c(/C=C1\Oc3cc(O)cc(O)c3C1=O)c(C)n2CCN1CCOCC1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 14081003 00000c08 20110309 d2010612 020410e4 02820100 c60c0281 00004640 01a60008 00b828c1 88a58004 4001c100 80808806 00608000 0316184b 024c215c 18004400 82900004 04238000 00020a02 40100000 3a028218 33808001 82588014 09042400 d0000000 a8522808 50000001 0845430c 20060052 84040210 00002620 |