On Target ESR1_HUMAN 0.5186916/CHEMBL238959
For the given ligand WIN, we have found in our database that, being scored 0.5186916, the most similar ligand is CHEMBL238959. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL238959 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | C[C@H](CCc1ccc(O)cc1)NC(=O)Cc1c(-c2ccccc2)[nH]c2c(OCCCN3CCCCC3)cccc12 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0400a002 01001a09 6010010a 51010610 00041020 06000004 06842001 20280000 00400880 100908c0 08300004 50059000 13808802 08608001 e1020041 020c200c 00220200 02002004 0ca00400 00420203 40000320 18248608 31804080 91508018 00842401 80000100 08120200 10000040 04004204 0006040b 00042a00 00002660 |