On Target PTGES_HUMAN 0.44343892/CHEMBL453202
For the given ligand WIN, we have found in our database that, being scored 0.44343892, the most similar ligand is CHEMBL453202. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL453202 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CC(C)Nc1ccc(-n2c(C(=O)O)c(-c3ccc(OC(C)C)cc3)c3cc(Cc4ccc(C(C)(C)C)cc4)ccc32)cc1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0c00e002 00805a09 20000108 10010610 20041021 0400e008 02040000 01001004 00500300 000808c0 08280004 60018800 02808812 00708200 21020041 820c000c 00068000 82800004 0c200100 10020000 c0100040 18068a78 30802002 8140001c 00040001 e0080040 08020240 400008c0 0440c284 1006004b c0040200 00000620 |