On Target MIF_HUMAN 0.35/CHEMBL4208992
For the given ligand WIN, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL4208992. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL4208992 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | O=C(CCCOc1ccc2nc(-c3cn(-c4ccc(O)c(F)c4)nn3)ccc2c1)NCCCCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04040007 41011818 60104108 5a898f10 20141030 0a00c01c 42180444 25303a01 00002504 100848f0 88208004 60019840 04809886 08619000 11030061 920c200c 00070840 82403b00 8c652100 80463a05 40460340 381f8f68 21825048 8750401c 00352403 e0202200 305e0240 502020c1 2762c38c 10068403 d20e5618 1f016e08 |