On Target MK03_HUMAN 0.36097562/CHEMBL3797548
For the given ligand WIN, we have found in our database that, being scored 0.36097562, the most similar ligand is CHEMBL3797548. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3797548 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CC(CNC(=O)c1ccc2[nH]nc(-c3ccncc3)c2c1)Oc1ccccc1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0400200a 0000d808 a0104108 40010602 01041080 00000002 02400000 02001000 00000100 00000840 00200004 60008000 80808812 00400000 01001401 000c200c 10220000 02000004 04600000 10220200 40000000 1c068608 32800800 0060401c 00100000 c0000000 10820000 80000061 00004304 00060001 a0040400 00004220 |