On Target NMDZ1_HUMAN 0.30627307/CHEMBL164322
For the given ligand Udenafil, we have found in our database that, being scored 0.30627307, the most similar ligand is CHEMBL164322. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL164322 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=C(O)c1[nH]c2cc(Cl)cc(Cl)c2c1CNS(=O)(=O)c1ccccc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00018012 08800800 01180100 11b10610 000c1020 0000c020 04004001 00001800 00000380 00083840 01182004 60008800 0200888c 00708401 80220040 020c000c 0000a008 0290000c 00600000 10006000 c0000080 08068be8 20812002 8840000c 02046000 82000404 c8040000 0000000c 00000404 20060001 c0040200 80430360 |