On Target PERM_HUMAN 0.3181818/CHEMBL2170247
For the given ligand Udenafil, we have found in our database that, being scored 0.3181818, the most similar ligand is CHEMBL2170247. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL2170247 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Cn1c(=O)[nH]c(=O)c2c1nc(NCCN)n2CCCOc1ccccc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0401002e 00801808 20280048 02010700 00081060 0200c040 0200a000 00000800 06400100 a08008e0 0c20800c 40019000 04809002 00c02000 01280081 100c200c 00a00000 0008c000 00c00000 00a20000 80000100 7e000040 21804841 00700014 40040000 c0200000 62000200 00040000 09004218 00461800 c0081000 800002c8 |