On Target PDE5A_HUMAN 0.94418603/CHEMBL3401752
For the given ligand Udenafil, we have found in our database that, being scored 0.94418603, the most similar ligand is CHEMBL3401752. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3401752 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(S(=O)(=O)NCCCN(C)C)ccc3OCC)nc12 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0481001e 00804408 21101108 11b10610 01085160 0001c002 06013800 01080300 06400900 904e19f0 a130a004 60008040 08808002 00600801 81a20081 020c210c 10002020 0680a00c 00600c00 40667443 c5000102 38010060 a5804840 1a700418 06142002 c000000d 28930800 0004108c 00404704 20460c12 41000800 402506e0 |