On Target COMT_HUMAN 0.36820084/CHEMBL4174978
For the given ligand Udenafil, we have found in our database that, being scored 0.36820084, the most similar ligand is CHEMBL4174978. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL4174978 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=S(=O)(c1ccc(O)c2ncccc12)N1CCCC1Cc1ccccc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00000052 21804008 61104102 01b10600 000c0000 00000014 02010000 00200000 00000880 004808c0 08302004 60018000 00000803 00600001 80600040 0004000c 00002010 02000000 00602800 00026601 e0000100 18208018 20800000 99400018 02000400 80000004 00000000 0000008c 04000402 20060002 00040000 00012670 |