On Target TRPV1_RAT 0.3754153/CHEMBL3940442
For the given ligand Udenafil, we have found in our database that, being scored 0.3754153, the most similar ligand is CHEMBL3940442. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3940442 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CC(C)c1nc2c(c(Nc3ccc(S(=O)(=O)N4CCCC4)cc3)n1)CCN(c1ncccc1C(F)(F)F)CC2 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0400401a 00802800 01104100 59bc0610 250c1030 20004050 0000bc10 00100849 10402180 204d0ad0 2030a004 60809800 14000882 02309001 81620040 001c0006 0024aa20 1a104004 0860201a 50a06601 cd100800 1c64a000 20804840 19600159 02043002 00000204 0a000088 900010cc 0448840c 20660802 40101000 200122f2 |