On Target PAR1_HUMAN 0.39811912/CHEMBL3086219
For the given ligand Udenafil, we have found in our database that, being scored 0.39811912, the most similar ligand is CHEMBL3086219. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3086219 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Cc1c(C)c(S(=O)(=O)/N=C(\N)NCCC[C@H]2C(=O)N(Cc3ccccc3)C[C@H]([C@H](Cc3c[nH]c4ccccc34)NC(=O)NCc3ccccc3)N2Cc2ccccc2)c(C)c2c1OC(C)(C)C2 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 14019012 41807e08 2110210a 45b10e10 00041341 02014000 02002004 2200324c 00f00b00 000b99e2 09302004 6003f840 1e80b812 02682881 813604c5 001c211c 0c004098 6220a000 04280c40 00022209 c0000100 382d8628 21804023 9b500018 00052000 c0402001 48800000 910400cc 0c040310 2006081b a01c4210 a0013622 |