On Target MK01_HUMAN 0.36/CHEMBL3917319
For the given ligand Udenafil, we have found in our database that, being scored 0.36, the most similar ligand is CHEMBL3917319. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3917319 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Nc1ncc(C2CCOCC2)nc1-c1ccc(C(=O)N[C@@H]2CCCN(S(=O)(=O)c3ccccc3)C2)c(F)c1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0000009a 03803808 01100580 57b10730 84080040 04000018 1002a000 22081048 14600900 1049a8c0 0020a000 7003a000 80018842 00103801 80e20400 800c900c 0a02a200 06002000 04600408 10606601 80000020 38068600 210008c1 3a40003c 02040401 c2080004 08002208 9000104d 0800470c 20e69801 a0040882 200102f0 |