On Target TRPV3_HUMAN 0.38022813/CHEMBL3692262
For the given ligand Udenafil, we have found in our database that, being scored 0.38022813, the most similar ligand is CHEMBL3692262. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3692262 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CC(C)[C@H](CO)NCc1nc(-c2cccc(S(=O)(=O)N3CCCCC3)c2)ccc1F |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0000209a 01800000 01104100 17b10e00 008c01a1 00190022 00400000 02083041 00000000 104208c0 00212004 70018010 00000802 00001001 80620480 020c010d 12022200 02002022 04600000 00506601 c0000003 18018000 33800000 38400018 02100000 c0000004 00000c40 9000104d 00004504 20260402 21040800 20014270 |