On Target AOFA_HUMAN 0.35789475/CHEMBL1258955
For the given ligand Udenafil, we have found in our database that, being scored 0.35789475, the most similar ligand is CHEMBL1258955. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL1258955 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | COc1ccc(-c2nnc3c(C(=O)c4ccccc4)nc4ccccc4n23)cc1OC |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0800800a 43800808 e0001588 19810610 01045060 0008c006 02c4a000 01681900 10400100 11080850 28088004 4080a800 0200c822 00500001 018e08c1 020ca08c 08018000 02802005 00680400 40662a01 c5000020 28028620 a1806804 0042401c 00040400 80000000 18028000 40000824 00000284 00021c0b c0040a80 20200400 |