On Target PPARG_HUMAN 0.39661017/CHEMBL1089633
For the given ligand Udenafil, we have found in our database that, being scored 0.39661017, the most similar ligand is CHEMBL1089633. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL1089633 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Cc1oc(-c2ccccc2)nc1CCOc1ccc(C[C@@H](C(=O)O)N2CCN(S(=O)(=O)c3ccccc3F)CC2)cc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04401293 00800018 21181108 17b10610 000810c1 12004010 02060400 008c0140 0000c980 180a1850 0830a001 6000b002 86818c02 00203001 81320021 100ca00c 1000a020 02002800 00601208 40c2e201 85240100 38300a28 23004061 af500038 02050800 a0004004 04120008 1800100d 8c000605 20268802 40444802 20010660 |