On Target CASP1_HUMAN 0.37942123/CHEMBL248309
For the given ligand Udenafil, we have found in our database that, being scored 0.37942123, the most similar ligand is CHEMBL248309. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL248309 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CCC(C(=O)N[C@@H](CC(=O)O)C(=O)CCCc1ccccc1)n1cc(C(C)(C)C)nc(Nc2ccc3c(c2)OCCO3)c1=O |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0405002a 81011408 2010150a 51a10638 01081044 0c002100 1200a214 20000008 16602901 800c18e0 0838800c 4001b010 0e80c02a 09e00001 81a209c1 080c800c 08040000 d2005001 08c02412 10a22603 c0000180 7854ae10 25000881 0a70041e 04041003 c0000000 08040400 1081008c 08008e0e 0046181b 600a4000 2042268a |