On Target PDE4B_HUMAN 0.3731884/CHEMBL3644501
For the given ligand Udenafil, we have found in our database that, being scored 0.3731884, the most similar ligand is CHEMBL3644501. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3644501 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | COc1cccc2c1ncc1c(=O)n(-c3cccc(Cl)c3)c(=O)n(C3CCN(S(C)(=O)=O)CC3)c12 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00008002 01800608 60104008 03310700 000c1040 020040e4 5e088002 00201000 06300100 c04009e0 0d20200c 50058800 02009806 09e40001 91f400c3 000c200c 08900008 0000c000 00600000 00024203 c0000080 18008178 21800041 91308010 02042400 c0000008 20008000 1004000c 04004200 00460018 400c0000 000306f0 |