On Target NK1R_HUMAN 0.38289964/CHEMBL202775
For the given ligand Udenafil, we have found in our database that, being scored 0.38289964, the most similar ligand is CHEMBL202775. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL202775 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=S(=O)(NCC1CC2(c3ccc(F)cc3)NC1CCC2NCc1cc(OC(F)(F)F)ccc1OC1CC1)c1ccccc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04000010 47800408 2110010a 07b10600 00091010 02000110 02000000 22001400 00300880 005909c0 08302000 70438000 00800802 01203001 81e00401 00082008 00002000 22008180 00482000 00127603 80000140 38208030 01000009 9b548018 02000000 c000000c 00080000 d000100d 0e000702 20068012 24060000 02012670 |