On Target ALDR_HUMAN 0.35555556/CHEMBL309132
For the given ligand Udenafil, we have found in our database that, being scored 0.35555556, the most similar ligand is CHEMBL309132. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL309132 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=C(O)Cc1nn(Cc2nc3cc(C(F)(F)F)ccc3s2)c(=O)c2cccnc12 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0003800e 10004c08 22167128 30010711 810c10e0 800080c2 02002480 00018209 06420000 d00c18d0 08018a0c 70019000 0300b8b7 01e08020 400e20c0 020f240e 18200000 0200408c 00600410 00660260 40001020 dc018ad8 61804841 82710090 06142002 cc000101 58010040 900c0004 01800104 00161642 00346000 00615620 |