On Target AOFB_HUMAN 0.34586465/CHEMBL2333936
For the given ligand Udenafil, we have found in our database that, being scored 0.34586465, the most similar ligand is CHEMBL2333936. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL2333936 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | C#CCN(C)[C@H](C)Cc1ccc(OCCCCCCNc2c3c(nc4ccccc24)CCCC3)cc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0400400a 01004008 6010410a 10810710 204c3120 02002040 0304a000 00100001 10400880 000808d0 08308004 40818000 00800802 00e00800 11120041 020c200e 00848200 06000004 08602408 00020201 44100100 18248018 21814000 81500010 00040000 80000001 08128040 10001080 04488206 00860002 000400a0 20000640 |