On Target ACM1_HUMAN 0.4110672/CHEMBL2057512
For the given ligand Udenafil, we have found in our database that, being scored 0.4110672, the most similar ligand is CHEMBL2057512. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL2057512 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=C(C1CN(S(=O)(=O)c2ccc3c(c2)CCO3)C1)N1CCN(c2ccncc2)CC1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04001012 00806408 21106128 05b10600 000c1140 02010000 02008000 00000248 00800000 00480b60 08202014 6000d000 08808802 00002001 81a40081 000c211c 08046004 02000000 04600810 00027602 c0100000 38048600 21800021 1a40001a 02000000 8000000c 00808000 0000108c 08000700 20060013 00000000 00010662 |