On Target PGH1_SHEEP 0.3309859/CHEMBL1835477
For the given ligand Udenafil, we have found in our database that, being scored 0.3309859, the most similar ligand is CHEMBL1835477. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL1835477 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CC(=O)Oc1cc(F)ccc1-c1cc(C(F)(F)F)nn1-c1ccc(S(N)(=O)=O)cc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04006036 00802208 a1100108 02b10600 01881010 00004032 02440400 00003400 00000104 000188f1 09002004 6000800a 00c08812 02001201 81210041 000c200c 00020000 06809000 04400000 00722008 c0100000 1801aa20 b0800800 8b40c048 00000000 c0000040 30c20000 90000869 0400430c 30468008 40260610 900126a2 |