On Target NMDE2_HUMAN 0.3467742/CHEMBL2013201
For the given ligand Udenafil, we have found in our database that, being scored 0.3467742, the most similar ligand is CHEMBL2013201. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL2013201 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Oc1ccc2[nH]c(-c3ccccc3)nc2c1CN1CCC(c2ccccc2)CC1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 10000002 01000a08 20100100 10050610 00040060 00004000 06004000 22081400 00000900 101808d0 49308004 50018000 00000806 00408000 00020440 020c200c 00020008 02002008 00200000 40460201 41000100 38008820 21800000 00500110 00046000 c0000000 00000040 90000000 00000104 00460c0a 64048800 802406a0 |