On Target GRM5_HUMAN 0.37769786/CHEMBL1808898
For the given ligand Udenafil, we have found in our database that, being scored 0.37769786, the most similar ligand is CHEMBL1808898. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL1808898 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Cc1cc(-c2cccc(Cl)c2)ncc1C1CC(O)CN1C(=O)c1cnccn1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 1000a01a 0180d800 00104902 10810e10 000411e0 00100010 0400f000 22083001 10500900 100808d0 01390004 40018800 82008806 00308800 808204a0 020c010c 18022000 02003006 04e00400 10406201 c5020100 18158f00 338040c0 00500118 00142001 c0000001 08004040 90000045 00404104 00060c03 a0000800 80020620 |