On Target 5HT2A_HUMAN 0.41509435/CHEMBL3642814
For the given ligand Udenafil, we have found in our database that, being scored 0.41509435, the most similar ligand is CHEMBL3642814. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3642814 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=S(=O)(N[C@H]1CC[C@H](CCN2CCN(c3nccc4c3CCO4)CC2)CC1)c1ccccc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0400501a 81804008 21104128 05b10610 000c1040 06000040 00002000 20000248 00400000 20482ac0 00202004 60018000 00000802 08002001 81660000 001c201c 1824a080 02004004 0a602400 00a46601 c0100000 7e008010 21800821 1a70001a 02040000 00000004 08000080 1000108c 08488718 20061802 00021000 202b0670 |