On Target P2Y12_HUMAN 0.3413793/CHEMBL2419489
For the given ligand Udenafil, we have found in our database that, being scored 0.3413793, the most similar ligand is CHEMBL2419489. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL2419489 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CCOC(=O)c1cc(C#N)c(N2CCC(C(=O)NS(=O)(=O)c3ccccc3)CC2)nc1C |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00024012 03800800 01104184 91f80610 210c1030 0000e040 10100000 20101000 10200100 20c128d0 00202004 70839800 04008802 00218001 80620900 1a0c000e 02462000 02004004 08e10000 40a06601 c0100000 1c04ae40 20800d01 1a70001c 02040400 80002004 080804c0 1000108c 0440860d 20060800 c0001004 00810270 |