On Target SCN9A_HUMAN 0.44/CHEMBL3341987
For the given ligand Udenafil, we have found in our database that, being scored 0.44, the most similar ligand is CHEMBL3341987. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3341987 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CCc1cc(S(=O)(=O)Nc2ccncn2)c(F)cc1O[C@H]1CCC[C@@H]1c1ccnn1C |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04001216 01804008 2111310a 0ab90700 010811c2 92014012 02048000 00000b40 00808900 000c88c0 0810a004 6000d040 08841c02 00a01001 91280081 002c210c 1c802000 26008080 04402800 00326049 80100000 1a211800 25840844 0a400418 00012200 c0000000 00920000 0800108d 0400070e 2146c002 404c0010 000106e0 |