On Target PRGR_HUMAN 0.390625/CHEMBL1085380
For the given ligand Udenafil, we have found in our database that, being scored 0.390625, the most similar ligand is CHEMBL1085380. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL1085380 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CCCNS(=O)(=O)c1ccc(-c2ccc3c(cnn3-c3ccc(F)cc3)c2)c(C(F)(F)F)c1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00002016 00801609 21100100 03b10600 000c0108 10014010 02000400 00001004 04100100 004108d0 01002004 60018000 00000802 01601001 a02000c0 000c010c 00022000 02000004 04600000 00226602 c4000000 1c018038 30801800 9b600038 02100000 80000404 00000000 9000106d 04004400 20468048 40140000 800146e0 |