On Target DRD4_HUMAN 0.36226416/CHEMBL313851
For the given ligand Udenafil, we have found in our database that, being scored 0.36226416, the most similar ligand is CHEMBL313851. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL313851 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | FC(F)(F)c1nc2c3c(ccc2[nH]1)CCC(CNCc1ccccc1)O3 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 0400200a 01004818 6010010a 50050702 000410e0 86004004 06800003 22001208 00100900 000808e0 0d308004 40058040 08800802 08608000 11321445 020c200c 10000000 0202800c 08600000 00060201 40000100 18048020 33800040 00500010 00002800 c0000200 00000240 90000041 00400304 00464802 60040000 002406a0 |