On Target 5HT1B_HUMAN 0.43153527/CHEMBL357634
For the given ligand Udenafil, we have found in our database that, being scored 0.43153527, the most similar ligand is CHEMBL357634. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL357634 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CN(C1CCN(CCCc2c[nH]c3ccc(-n4cnnc4)cc23)CC1)S(=O)(=O)c1ccccc1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00000012 01800e08 41100100 41b10610 000c1240 00000004 00042000 20001000 00400900 004809e0 08302004 70018000 88000802 00400801 80a40040 000c000c 0800a000 0200000c 00600400 00247603 c0000100 18008008 21800000 98500018 02042000 8000000c 08000080 1000000c 00000400 2006001a 80040200 00212660 |