On Target OPRX_HUMAN 0.37656903/CHEMBL480425
For the given ligand Udenafil, we have found in our database that, being scored 0.37656903, the most similar ligand is CHEMBL480425. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL480425 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | CC1(N2CCC(n3c(-c4cccc(OCCO)c4)nc4ccccc43)CC2)CCCCCCC1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04004002 41000408 20100108 10810600 200c1060 00006000 02000000 20080000 00200100 100019c0 0120800c 50018000 00801002 01c40080 012200c1 020c000c 00100080 02002000 00682000 00422201 c0100000 38000030 a5800001 08500010 00000000 c0000000 00000004 10800000 00000204 00460c10 400a0800 00002280 |