On Target FYN_HUMAN 0.38846153/CHEMBL3632719
For the given ligand Udenafil, we have found in our database that, being scored 0.38846153, the most similar ligand is CHEMBL3632719. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL3632719 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Cn1c(Nc2cccc(C(C)(C)C)c2)nc2cc(Oc3ccnc(-c4ncc(C(F)(F)F)[nH]4)c3)ccc21 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00000226 40000008 20104108 10810610 00041060 00004000 06084800 00080048 00400100 100808f0 0920800c 40018800 00001806 00500000 01020041 020c004c 00040020 1200600c 08682000 50e62000 c5400001 fc008030 a1800801 00600410 00042004 c0000000 04000040 90211080 0040828c 00661802 40000c00 002c0680 |