On Target TRXR1_HUMAN 0.21580547/CHEMBL4129274
For the given ligand Udenafil, we have found in our database that, being scored 0.21580547, the most similar ligand is CHEMBL4129274. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL4129274 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(CCOCCOCCOCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)CC3)cc2)ncc1Cl |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00054202 47007000 20100021 8c180e41 02000088 00006000 0200a014 28002cc0 05202100 02004ac1 003a2004 60079800 0401900e 00152100 001c1048 000f000c 14041000 10006100 0840206a 10a00301 c0180100 3c050710 36806b60 0a30001a 00011400 00000400 02804020 100100e1 08008208 02460821 440a1000 030302c0 |