On Target ESR1_HUMAN 0.35856575/CHEMBL1254532
For the given ligand Udenafil, we have found in our database that, being scored 0.35856575, the most similar ligand is CHEMBL1254532. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL1254532 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Oc1ccc2nc(-c3ccccc3)n(Cc3ccc(OCCN4CCCCC4)cc3)c2c1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04006002 01800208 20100108 10010602 200c10e0 00004000 06040000 20081000 80100100 100018c0 0120800c 50018000 00801806 00400000 010a10c1 020c000c 10000000 02002008 00680000 00460201 c0100000 38048030 33800041 81500011 00002000 c0000000 00220000 10000001 04000204 00460c08 400c0800 00240680 |