On Target MIF_HUMAN 0.29891303/CHEMBL4208992
For the given ligand Udenafil, we have found in our database that, being scored 0.29891303, the most similar ligand is CHEMBL4208992. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL4208992 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | O=C(CCCOc1ccc2nc(-c3cn(-c4ccc(O)c(F)c4)nn3)ccc2c1)NCCCCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04040007 41011818 60104108 5a898f10 20141030 0a00c01c 42180444 25303a01 00002504 100848f0 88208004 60019840 04809886 08619000 11030061 920c200c 00070840 82403b00 8c652100 80463a05 40460340 381f8f68 21825048 8750401c 00352403 e0202200 305e0240 502020c1 2762c38c 10068403 d20e5618 1f016e08 |