On Target NMDE1_HUMAN 0.25412542/CHEMBL4555447
For the given ligand Udenafil, we have found in our database that, being scored 0.25412542, the most similar ligand is CHEMBL4555447. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL4555447 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | Cc1ncc(CNNC(=O)c2cnc(CNS(=O)(=O)c3ccc(F)c(F)c3)c(C)n2)s1 |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 00020016 08c08000 01180804 13b01618 040c0040 000a0012 1400c881 00019809 10000080 41003858 41b92a00 70008000 00008010 08301021 b0a22488 00040204 09003000 02000080 07400011 80006400 a0001080 08089680 61004000 18410108 22140000 0e000006 88000010 0000180d 08040404 204e9803 80000000 80050260 |