On Target IKKB_HUMAN 0.37218046/CHEMBL2375673
For the given ligand Udenafil, we have found in our database that, being scored 0.37218046, the most similar ligand is CHEMBL2375673. Check out the elaboration below.
| Udenafil (Given Ligand) | CHEMBL2375673 (Similar Ligand) |
|---|---|
| CCCOc2ccc(S(=O)(=O)NCCC1CCCN1C)cc2c4nc3c(CCC)nn(C)c3c(=O)[nH]4 | C#Cc1c(C2CCNCC2)cc(-c2c(O)cccc2OCC2CC2)nc1N |
|
|
|
|
|
|
| 0481001e 01804408 21101108 11b10610 01085160 0201c012 06013800 01080300 06400900 904e19f0 a130a004 60018040 08808002 00600801 81e20081 020c210c 10002020 2680a00c 00602c00 40667643 c5000102 38010070 a5804840 1a700418 06142002 c000000d 28930800 1004108c 00404704 20460c12 41000800 402526f0 | 04012003 01004a08 a0104908 50010710 01443024 02000000 42000000 20082000 00400900 100808d0 80308004 50018004 88c00802 01208800 11020001 020c200c 00020000 2200b004 04600000 10620a11 41000000 1c008000 b1804800 02604011 00242004 80000081 380002c0 10000069 0041430c 1006040a 00000a00 00002320 |