On Target PDE5A_HUMAN 0.24271844/CHEMBL363889
For the given ligand pH, we have found in our database that, being scored 0.24271844, the most similar ligand is CHEMBL363889. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL363889 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CCc1cc(C(C)=O)c(O)cc1OCc1cccc(C(=O)NCC(=O)O)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 04008009 00004808 20000109 00010600 00001081 80024000 52040000 02001200 00000100 00080a40 48200000 4000a000 02808802 00010000 01000401 0a082008 10000000 02008000 00000000 40020800 00000000 08028e20 02000000 00c0101c 00004000 c0002000 08120000 80800000 00010300 00060003 e0044004 00000600 |